C19H24ClN3O4 — CID 42712369
ethyl 4-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl-methylamino]-4-oxobutanoate (PubChem CID 42712369) has the molecular formula C19H24ClN3O4 and a molecular weight of 393.87 g/mol. Its IUPAC name is ethyl 4-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl-methylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl-methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42712369 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | ethyl 4-[1-(7-chloro-3-ethyl-4-oxoquinazolin-2-yl)ethyl-methylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N(C)C(C)c1nc2cc(Cl)ccc2c(=O)n1CC |
| InChI | InChI=1S/C19H24ClN3O4/c1-5-23-18(21-15-11-13(20)7-8-14(15)19(23)26)12(3)22(4)16(24)9-10-17(25)27-6-2/h7-8,11-12H,5-6,9-10H2,1-4H3 |
| InChIKey | JWLNJIZZELZMDM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |