C24H35N3O4 — CID 42711715
ethyl 4-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl-hexylamino]-4-oxobutanoate (PubChem CID 42711715) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is ethyl 4-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl-hexylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl-hexylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42711715 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | ethyl 4-[1-(3-ethyl-4-oxoquinazolin-2-yl)ethyl-hexylamino]-4-oxobutanoate |
| SMILES | CCCCCCN(C(=O)CCC(=O)OCC)C(C)c1nc2ccccc2c(=O)n1CC |
| InChI | InChI=1S/C24H35N3O4/c1-5-8-9-12-17-27(21(28)15-16-22(29)31-7-3)18(4)23-25-20-14-11-10-13-19(20)24(30)26(23)6-2/h10-11,13-14,18H,5-9,12,15-17H2,1-4H3 |
| InChIKey | ZJHPSLDMKRQERA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|