C30H39N3O4 — CID 42717239
ethyl 4-[hexyl-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propyl]amino]-4-oxobutanoate (PubChem CID 42717239) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is ethyl 4-[hexyl-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propyl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[hexyl-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42717239 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | ethyl 4-[hexyl-[1-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propyl]amino]-4-oxobutanoate |
| SMILES | CCCCCCN(C(=O)CCC(=O)OCC)C(CC)c1nc2ccccc2c(=O)n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C30H39N3O4/c1-5-8-9-12-21-32(27(34)19-20-28(35)37-7-3)26(6-2)29-31-25-14-11-10-13-24(25)30(36)33(29)23-17-15-22(4)16-18-23/h10-11,13-18,26H,5-9,12,19-21H2,1-4H3 |
| InChIKey | SJQGWWGRIQUZDO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|