C28H38N4O2 — CID 42716453
N-[2-(dimethylamino)ethyl]-N-[1-(4-oxo-3-phenylquinazolin-2-yl)propyl]heptanamide (PubChem CID 42716453) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[1-(4-oxo-3-phenylquinazolin-2-yl)propyl]heptanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[1-(4-oxo-3-phenylquinazolin-2-yl)propyl]heptanamide |
|---|---|
| PubChem CID | 42716453 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[1-(4-oxo-3-phenylquinazolin-2-yl)propyl]heptanamide |
| SMILES | CCCCCCC(=O)N(CCN(C)C)C(CC)c1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H38N4O2/c1-5-7-8-12-19-26(33)31(21-20-30(3)4)25(6-2)27-29-24-18-14-13-17-23(24)28(34)32(27)22-15-10-9-11-16-22/h9-11,13-18,25H,5-8,12,19-21H2,1-4H3 |
| InChIKey | DBXQPJPBNLPICU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|