C32H46N4O2 — CID 4600532
N-[2-(dimethylamino)ethyl]-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]decanamide (PubChem CID 4600532) has the molecular formula C32H46N4O2 and a molecular weight of 518.75 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]decanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]decanamide |
|---|---|
| PubChem CID | 4600532 |
| Molecular Formula | C32H46N4O2 |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]decanamide |
| SMILES | CCCCCCCCCC(=O)N(CCN(C)C)C(CC)c1nc2ccccc2c(=O)n1-c1cccc(C)c1 |
| InChI | InChI=1S/C32H46N4O2/c1-6-8-9-10-11-12-13-21-30(37)35(23-22-34(4)5)29(7-2)31-33-28-20-15-14-19-27(28)32(38)36(31)26-18-16-17-25(3)24-26/h14-20,24,29H,6-13,21-23H2,1-5H3 |
| InChIKey | PHGWUCLEGJYZBR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|