C26H31N3O4 — CID 42719134
ethyl 4-[ethyl-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]amino]-4-oxobutanoate (PubChem CID 42719134) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is ethyl 4-[ethyl-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[ethyl-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 42719134 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | ethyl 4-[ethyl-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N(CC)C(CC)c1nc2ccccc2c(=O)n1-c1cccc(C)c1 |
| InChI | InChI=1S/C26H31N3O4/c1-5-22(28(6-2)23(30)15-16-24(31)33-7-3)25-27-21-14-9-8-13-20(21)26(32)29(25)19-12-10-11-18(4)17-19/h8-14,17,22H,5-7,15-16H2,1-4H3 |
| InChIKey | USMHUQUMZTXDJY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |