C32H32N4O2 — CID 42718648
1-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-3-naphthalen-1-yl-1-propylurea (PubChem CID 42718648) has the molecular formula C32H32N4O2 and a molecular weight of 504.63 g/mol. Its IUPAC name is 1-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-3-naphthalen-1-yl-1-propylurea.
| Compound Name | 1-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-3-naphthalen-1-yl-1-propylurea |
|---|---|
| PubChem CID | 42718648 |
| Molecular Formula | C32H32N4O2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 1-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-3-naphthalen-1-yl-1-propylurea |
| SMILES | CCCN(C(=O)Nc1cccc2ccccc12)C(CC)c1nc2ccccc2c(=O)n1-c1cccc(C)c1 |
| InChI | InChI=1S/C32H32N4O2/c1-4-20-35(32(38)34-27-19-11-14-23-13-6-7-16-25(23)27)29(5-2)30-33-28-18-9-8-17-26(28)31(37)36(30)24-15-10-12-22(3)21-24/h6-19,21,29H,4-5,20H2,1-3H3,(H,34,38) |
| InChIKey | UNFWUOQCJZGGRN-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |