C30H32Cl2N4O2 — CID 42718667
3-(2,4-dichlorophenyl)-1-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-1-pentylurea (PubChem CID 42718667) has the molecular formula C30H32Cl2N4O2 and a molecular weight of 551.52 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-1-pentylurea.
| Compound Name | 3-(2,4-dichlorophenyl)-1-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-1-pentylurea |
|---|---|
| PubChem CID | 42718667 |
| Molecular Formula | C30H32Cl2N4O2 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]propyl]-1-pentylurea |
| SMILES | CCCCCN(C(=O)Nc1ccc(Cl)cc1Cl)C(CC)c1nc2ccccc2c(=O)n1-c1cccc(C)c1 |
| InChI | InChI=1S/C30H32Cl2N4O2/c1-4-6-9-17-35(30(38)34-26-16-15-21(31)19-24(26)32)27(5-2)28-33-25-14-8-7-13-23(25)29(37)36(28)22-12-10-11-20(3)18-22/h7-8,10-16,18-19,27H,4-6,9,17H2,1-3H3,(H,34,38) |
| InChIKey | WUNJJFHSDGIMAY-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|