C27H26Cl2N4O2 — CID 42716184
3-(2,3-dichlorophenyl)-1-[1-(4-oxo-3-phenylquinazolin-2-yl)propyl]-1-propylurea (PubChem CID 42716184) has the molecular formula C27H26Cl2N4O2 and a molecular weight of 509.44 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1-[1-(4-oxo-3-phenylquinazolin-2-yl)propyl]-1-propylurea.
| Compound Name | 3-(2,3-dichlorophenyl)-1-[1-(4-oxo-3-phenylquinazolin-2-yl)propyl]-1-propylurea |
|---|---|
| PubChem CID | 42716184 |
| Molecular Formula | C27H26Cl2N4O2 |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1-[1-(4-oxo-3-phenylquinazolin-2-yl)propyl]-1-propylurea |
| SMILES | CCCN(C(=O)Nc1cccc(Cl)c1Cl)C(CC)c1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C27H26Cl2N4O2/c1-3-17-32(27(35)31-22-16-10-14-20(28)24(22)29)23(4-2)25-30-21-15-9-8-13-19(21)26(34)33(25)18-11-6-5-7-12-18/h5-16,23H,3-4,17H2,1-2H3,(H,31,35) |
| InChIKey | PVWKCPZKMXJIRG-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |