C29H29BrCl2N4O2 — CID 4538880
1-[1-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(2,3-dichlorophenyl)-1-hexylurea (PubChem CID 4538880) has the molecular formula C29H29BrCl2N4O2 and a molecular weight of 616.39 g/mol. Its IUPAC name is 1-[1-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(2,3-dichlorophenyl)-1-hexylurea.
| Compound Name | 1-[1-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(2,3-dichlorophenyl)-1-hexylurea |
|---|---|
| PubChem CID | 4538880 |
| Molecular Formula | C29H29BrCl2N4O2 |
| Molecular Weight | 616.39 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | 1-[1-[3-(4-bromophenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(2,3-dichlorophenyl)-1-hexylurea |
| SMILES | CCCCCCN(C(=O)Nc1cccc(Cl)c1Cl)C(C)c1nc2ccccc2c(=O)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C29H29BrCl2N4O2/c1-3-4-5-8-18-35(29(38)34-25-13-9-11-23(31)26(25)32)19(2)27-33-24-12-7-6-10-22(24)28(37)36(27)21-16-14-20(30)15-17-21/h6-7,9-17,19H,3-5,8,18H2,1-2H3,(H,34,38) |
| InChIKey | CAZRCCKQUOTAJD-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.39 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|