C30H34N4O2 — CID 42718560
3-(2-methylphenyl)-1-[1-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-1-pentylurea (PubChem CID 42718560) has the molecular formula C30H34N4O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 3-(2-methylphenyl)-1-[1-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-1-pentylurea.
| Compound Name | 3-(2-methylphenyl)-1-[1-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-1-pentylurea |
|---|---|
| PubChem CID | 42718560 |
| Molecular Formula | C30H34N4O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 3-(2-methylphenyl)-1-[1-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-1-pentylurea |
| SMILES | CCCCCN(C(=O)Nc1ccccc1C)C(C)c1nc2ccccc2c(=O)n1-c1ccccc1C |
| InChI | InChI=1S/C30H34N4O2/c1-5-6-13-20-33(30(36)32-25-17-10-7-14-21(25)2)23(4)28-31-26-18-11-9-16-24(26)29(35)34(28)27-19-12-8-15-22(27)3/h7-12,14-19,23H,5-6,13,20H2,1-4H3,(H,32,36) |
| InChIKey | LKLCTEOUEDKKSD-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|