C24H30N4O3 — CID 42713179
1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-(2-methylphenyl)-1-propylurea (PubChem CID 42713179) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-(2-methylphenyl)-1-propylurea.
| Compound Name | 1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-(2-methylphenyl)-1-propylurea |
|---|---|
| PubChem CID | 42713179 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3-(2-methylphenyl)-1-propylurea |
| SMILES | CCCN(C(=O)Nc1ccccc1C)C(C)c1nc2ccccc2c(=O)n1CCOC |
| InChI | InChI=1S/C24H30N4O3/c1-5-14-27(24(30)26-20-12-8-6-10-17(20)2)18(3)22-25-21-13-9-7-11-19(21)23(29)28(22)15-16-31-4/h6-13,18H,5,14-16H2,1-4H3,(H,26,30) |
| InChIKey | MPZFHEHFUSDTNC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |