C24H29ClN4O3 — CID 42713184
1-butyl-3-(3-chlorophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]urea (PubChem CID 42713184) has the molecular formula C24H29ClN4O3 and a molecular weight of 456.97 g/mol. Its IUPAC name is 1-butyl-3-(3-chlorophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]urea.
| Compound Name | 1-butyl-3-(3-chlorophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 42713184 |
| Molecular Formula | C24H29ClN4O3 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 1-butyl-3-(3-chlorophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]urea |
| SMILES | CCCCN(C(=O)Nc1cccc(Cl)c1)C(C)c1nc2ccccc2c(=O)n1CCOC |
| InChI | InChI=1S/C24H29ClN4O3/c1-4-5-13-28(24(31)26-19-10-8-9-18(25)16-19)17(2)22-27-21-12-7-6-11-20(21)23(30)29(22)14-15-32-3/h6-12,16-17H,4-5,13-15H2,1-3H3,(H,26,31) |
| InChIKey | RFTSFCCDDGHAKB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |