C25H31BrN4O3 — CID 42717799
3-(3-bromophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-1-pentylurea (PubChem CID 42717799) has the molecular formula C25H31BrN4O3 and a molecular weight of 515.45 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-1-pentylurea.
| Compound Name | 3-(3-bromophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-1-pentylurea |
|---|---|
| PubChem CID | 42717799 |
| Molecular Formula | C25H31BrN4O3 |
| Molecular Weight | 515.45 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 3-(3-bromophenyl)-1-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-1-pentylurea |
| SMILES | CCCCCN(C(=O)Nc1cccc(Br)c1)C(C)c1nc2ccccc2c(=O)n1CCOC |
| InChI | InChI=1S/C25H31BrN4O3/c1-4-5-8-14-29(25(32)27-20-11-9-10-19(26)17-20)18(2)23-28-22-13-7-6-12-21(22)24(31)30(23)15-16-33-3/h6-7,9-13,17-18H,4-5,8,14-16H2,1-3H3,(H,27,32) |
| InChIKey | AJJXQZPLFPGELC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|