C26H42N4O3 — CID 3647553
N-(6-aminohexyl)-N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]heptanamide (PubChem CID 3647553) has the molecular formula C26H42N4O3 and a molecular weight of 458.65 g/mol. Its IUPAC name is N-(6-aminohexyl)-N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]heptanamide.
| Compound Name | N-(6-aminohexyl)-N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]heptanamide |
|---|---|
| PubChem CID | 3647553 |
| Molecular Formula | C26H42N4O3 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.33 |
| IUPAC Name | N-(6-aminohexyl)-N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]heptanamide |
| SMILES | CCCCCCC(=O)N(CCCCCCN)C(C)c1nc2ccccc2c(=O)n1CCOC |
| InChI | InChI=1S/C26H42N4O3/c1-4-5-6-9-16-24(31)29(18-13-8-7-12-17-27)21(2)25-28-23-15-11-10-14-22(23)26(32)30(25)19-20-33-3/h10-11,14-15,21H,4-9,12-13,16-20,27H2,1-3H3 |
| InChIKey | NQJULYHHEPCYHY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|