C30H36N4O3 — CID 93105333
N-(6-aminohexyl)-N-[(1R)-1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]naphthalene-1-carboxamide (PubChem CID 93105333) has the molecular formula C30H36N4O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is N-(6-aminohexyl)-N-[(1R)-1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]naphthalene-1-carboxamide.
| Compound Name | N-(6-aminohexyl)-N-[(1R)-1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 93105333 |
| Molecular Formula | C30H36N4O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | N-(6-aminohexyl)-N-[(1R)-1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]naphthalene-1-carboxamide |
| SMILES | COCCn1c([C@@H](C)N(CCCCCCN)C(=O)c2cccc3ccccc23)nc2ccccc2c1=O |
| InChI | InChI=1S/C30H36N4O3/c1-22(28-32-27-17-8-7-15-26(27)30(36)34(28)20-21-37-2)33(19-10-4-3-9-18-31)29(35)25-16-11-13-23-12-5-6-14-24(23)25/h5-8,11-17,22H,3-4,9-10,18-21,31H2,1-2H3/t22-/m1/s1 |
| InChIKey | LECVSYRPFHNWOM-JOCHJYFZSA-N |
| XLogP | 4.92 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|