C28H32F6N4O3 — CID 3902636
N-(6-aminohexyl)-N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 3902636) has the molecular formula C28H32F6N4O3 and a molecular weight of 586.58 g/mol. Its IUPAC name is N-(6-aminohexyl)-N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(6-aminohexyl)-N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3902636 |
| Molecular Formula | C28H32F6N4O3 |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | N-(6-aminohexyl)-N-[1-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]ethyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | COCCn1c(C(C)N(CCCCCCN)C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C28H32F6N4O3/c1-18(24-36-23-10-6-5-9-22(23)26(40)38(24)13-14-41-2)37(12-8-4-3-7-11-35)25(39)19-15-20(27(29,30)31)17-21(16-19)28(32,33)34/h5-6,9-10,15-18H,3-4,7-8,11-14,35H2,1-2H3 |
| InChIKey | CRGYTZCEHBULGE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|