C25H28ClF3N4O2 — CID 4666240
N-(6-aminohexyl)-N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 4666240) has the molecular formula C25H28ClF3N4O2 and a molecular weight of 508.97 g/mol. Its IUPAC name is N-(6-aminohexyl)-N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-(6-aminohexyl)-N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 4666240 |
| Molecular Formula | C25H28ClF3N4O2 |
| Molecular Weight | 508.97 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N-(6-aminohexyl)-N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(c1nc2cc(Cl)ccc2c(=O)n1C)N(CCCCCCN)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H28ClF3N4O2/c1-16(22-31-21-15-19(26)11-12-20(21)24(35)32(22)2)33(14-6-4-3-5-13-30)23(34)17-7-9-18(10-8-17)25(27,28)29/h7-12,15-16H,3-6,13-14,30H2,1-2H3 |
| InChIKey | FHOSMUUHEOTVGL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.97 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|