C23H26ClN3O3 — CID 42728218
N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-(3-methoxypropyl)-4-methylbenzamide (PubChem CID 42728218) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-(3-methoxypropyl)-4-methylbenzamide.
| Compound Name | N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-(3-methoxypropyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 42728218 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[1-(7-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-(3-methoxypropyl)-4-methylbenzamide |
| SMILES | COCCCN(C(=O)c1ccc(C)cc1)C(C)c1nc2cc(Cl)ccc2c(=O)n1C |
| InChI | InChI=1S/C23H26ClN3O3/c1-15-6-8-17(9-7-15)22(28)27(12-5-13-30-4)16(2)21-25-20-14-18(24)10-11-19(20)23(29)26(21)3/h6-11,14,16H,5,12-13H2,1-4H3 |
| InChIKey | LTMBJUJVGBPVLK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|