C29H31N3O3 — CID 42728858
N-[1-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)benzamide (PubChem CID 42728858) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[1-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | N-[1-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 42728858 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-[1-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCN(C(=O)c1ccccc1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(C)cc1C |
| InChI | InChI=1S/C29H31N3O3/c1-20-15-16-26(21(2)19-20)32-27(30-25-14-9-8-13-24(25)29(32)34)22(3)31(17-10-18-35-4)28(33)23-11-6-5-7-12-23/h5-9,11-16,19,22H,10,17-18H2,1-4H3 |
| InChIKey | ASAQFJQTFZADCU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|