C29H31FN4O3 — CID 42728881
1-[1-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(3-fluorophenyl)-1-(3-methoxypropyl)urea (PubChem CID 42728881) has the molecular formula C29H31FN4O3 and a molecular weight of 502.59 g/mol. Its IUPAC name is 1-[1-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(3-fluorophenyl)-1-(3-methoxypropyl)urea.
| Compound Name | 1-[1-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(3-fluorophenyl)-1-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 42728881 |
| Molecular Formula | C29H31FN4O3 |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 1-[1-[3-(2,4-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(3-fluorophenyl)-1-(3-methoxypropyl)urea |
| SMILES | COCCCN(C(=O)Nc1cccc(F)c1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(C)cc1C |
| InChI | InChI=1S/C29H31FN4O3/c1-19-13-14-26(20(2)17-19)34-27(32-25-12-6-5-11-24(25)28(34)35)21(3)33(15-8-16-37-4)29(36)31-23-10-7-9-22(30)18-23/h5-7,9-14,17-18,21H,8,15-16H2,1-4H3,(H,31,36) |
| InChIKey | YFOQIEADCAKQDS-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|