C31H35N3O3 — CID 16722317
N-[1-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-methoxy-N-pentylbenzamide (PubChem CID 16722317) has the molecular formula C31H35N3O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-[1-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-methoxy-N-pentylbenzamide.
| Compound Name | N-[1-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-methoxy-N-pentylbenzamide |
|---|---|
| PubChem CID | 16722317 |
| Molecular Formula | C31H35N3O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | N-[1-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-methoxy-N-pentylbenzamide |
| SMILES | CCCCCN(C(=O)c1ccc(OC)cc1)C(C)c1nc2ccccc2c(=O)n1-c1cc(C)ccc1C |
| InChI | InChI=1S/C31H35N3O3/c1-6-7-10-19-33(30(35)24-15-17-25(37-5)18-16-24)23(4)29-32-27-12-9-8-11-26(27)31(36)34(29)28-20-21(2)13-14-22(28)3/h8-9,11-18,20,23H,6-7,10,19H2,1-5H3 |
| InChIKey | TYMGMGIDQMQUBE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|