C28H37N3O3 — CID 42723674
N-hexyl-N-[1-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]butanamide (PubChem CID 42723674) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-hexyl-N-[1-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]butanamide.
| Compound Name | N-hexyl-N-[1-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 42723674 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-hexyl-N-[1-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]butanamide |
| SMILES | CCCCCCN(C(=O)CCC)C(C)c1nc2ccccc2c(=O)n1-c1cc(C)ccc1OC |
| InChI | InChI=1S/C28H37N3O3/c1-6-8-9-12-18-30(26(32)13-7-2)21(4)27-29-23-15-11-10-14-22(23)28(33)31(27)24-19-20(3)16-17-25(24)34-5/h10-11,14-17,19,21H,6-9,12-13,18H2,1-5H3 |
| InChIKey | OYVWNEPAMPAPJT-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|