C26H33N3O3 — CID 42720914
N-ethyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]heptanamide (PubChem CID 42720914) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-ethyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]heptanamide.
| Compound Name | N-ethyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]heptanamide |
|---|---|
| PubChem CID | 42720914 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | N-ethyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]heptanamide |
| SMILES | CCCCCCC(=O)N(CC)C(C)c1nc2ccccc2c(=O)n1-c1ccccc1OC |
| InChI | InChI=1S/C26H33N3O3/c1-5-7-8-9-18-24(30)28(6-2)19(3)25-27-21-15-11-10-14-20(21)26(31)29(25)22-16-12-13-17-23(22)32-4/h10-17,19H,5-9,18H2,1-4H3 |
| InChIKey | KTNYFMIVMBOFNJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|