C28H37N3O2 — CID 42721417
N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(2-methylpropyl)hexanamide (PubChem CID 42721417) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(2-methylpropyl)hexanamide.
| Compound Name | N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(2-methylpropyl)hexanamide |
|---|---|
| PubChem CID | 42721417 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(2-methylpropyl)hexanamide |
| SMILES | CCCCCC(=O)N(CC(C)C)C(C)c1nc2ccccc2c(=O)n1-c1ccccc1CC |
| InChI | InChI=1S/C28H37N3O2/c1-6-8-9-18-26(32)30(19-20(3)4)21(5)27-29-24-16-12-11-15-23(24)28(33)31(27)25-17-13-10-14-22(25)7-2/h10-17,20-21H,6-9,18-19H2,1-5H3 |
| InChIKey | FGYYSZMHPMPDKE-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|