C28H36ClN3O2 — CID 3513014
N-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)hexanamide (PubChem CID 3513014) has the molecular formula C28H36ClN3O2 and a molecular weight of 482.07 g/mol. Its IUPAC name is N-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)hexanamide.
| Compound Name | N-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)hexanamide |
|---|---|
| PubChem CID | 3513014 |
| Molecular Formula | C28H36ClN3O2 |
| Molecular Weight | 482.07 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | N-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)hexanamide |
| SMILES | CCCCCC(=O)N(CCC(C)C)C(C)c1nc2ccccc2c(=O)n1-c1cccc(Cl)c1C |
| InChI | InChI=1S/C28H36ClN3O2/c1-6-7-8-16-26(33)31(18-17-19(2)3)21(5)27-30-24-14-10-9-12-22(24)28(34)32(27)25-15-11-13-23(29)20(25)4/h9-15,19,21H,6-8,16-18H2,1-5H3 |
| InChIKey | CAIFBZSVAYGGQW-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.07 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|