C29H36ClN3O4 — CID 3917879
ethyl 4-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl-hexylamino]-4-oxobutanoate (PubChem CID 3917879) has the molecular formula C29H36ClN3O4 and a molecular weight of 526.08 g/mol. Its IUPAC name is ethyl 4-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl-hexylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl-hexylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 3917879 |
| Molecular Formula | C29H36ClN3O4 |
| Molecular Weight | 526.08 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | ethyl 4-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl-hexylamino]-4-oxobutanoate |
| SMILES | CCCCCCN(C(=O)CCC(=O)OCC)C(C)c1nc2ccccc2c(=O)n1-c1cccc(Cl)c1C |
| InChI | InChI=1S/C29H36ClN3O4/c1-5-7-8-11-19-32(26(34)17-18-27(35)37-6-2)21(4)28-31-24-15-10-9-13-22(24)29(36)33(28)25-16-12-14-23(30)20(25)3/h9-10,12-16,21H,5-8,11,17-19H2,1-4H3 |
| InChIKey | GLTQGJQOVSEBGO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.08 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|