C27H28ClN3O3 — CID 42720429
N-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylfuran-2-carboxamide (PubChem CID 42720429) has the molecular formula C27H28ClN3O3 and a molecular weight of 477.99 g/mol. Its IUPAC name is N-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylfuran-2-carboxamide.
| Compound Name | N-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylfuran-2-carboxamide |
|---|---|
| PubChem CID | 42720429 |
| Molecular Formula | C27H28ClN3O3 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylfuran-2-carboxamide |
| SMILES | CCCCCN(C(=O)c1ccco1)C(C)c1nc2ccccc2c(=O)n1-c1cccc(Cl)c1C |
| InChI | InChI=1S/C27H28ClN3O3/c1-4-5-8-16-30(27(33)24-15-10-17-34-24)19(3)25-29-22-13-7-6-11-20(22)26(32)31(25)23-14-9-12-21(28)18(23)2/h6-7,9-15,17,19H,4-5,8,16H2,1-3H3 |
| InChIKey | IMKAPFSEUAUWQX-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|