C29H32BrN3O5 — CID 42723121
N-[1-[3-(2-bromo-3,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylfuran-2-carboxamide (PubChem CID 42723121) has the molecular formula C29H32BrN3O5 and a molecular weight of 582.50 g/mol. Its IUPAC name is N-[1-[3-(2-bromo-3,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylfuran-2-carboxamide.
| Compound Name | N-[1-[3-(2-bromo-3,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylfuran-2-carboxamide |
|---|---|
| PubChem CID | 42723121 |
| Molecular Formula | C29H32BrN3O5 |
| Molecular Weight | 582.50 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | N-[1-[3-(2-bromo-3,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylfuran-2-carboxamide |
| SMILES | CCCCCCN(C(=O)c1ccco1)C(C)c1nc2ccccc2c(=O)n1-c1cc(OC)cc(OC)c1Br |
| InChI | InChI=1S/C29H32BrN3O5/c1-5-6-7-10-15-32(29(35)24-14-11-16-38-24)19(2)27-31-22-13-9-8-12-21(22)28(34)33(27)23-17-20(36-3)18-25(37-4)26(23)30/h8-9,11-14,16-19H,5-7,10,15H2,1-4H3 |
| InChIKey | XAVTWGYYVBEHMB-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 86.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.50 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|