C29H29BrN4O6 — CID 42657685
N-[1-[3-(2-bromo-3,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-butyl-4-nitrobenzamide (PubChem CID 42657685) has the molecular formula C29H29BrN4O6 and a molecular weight of 609.48 g/mol. Its IUPAC name is N-[1-[3-(2-bromo-3,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-butyl-4-nitrobenzamide.
| Compound Name | N-[1-[3-(2-bromo-3,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-butyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 42657685 |
| Molecular Formula | C29H29BrN4O6 |
| Molecular Weight | 609.48 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | N-[1-[3-(2-bromo-3,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-butyl-4-nitrobenzamide |
| SMILES | CCCCN(C(=O)c1ccc([N+](=O)[O-])cc1)C(C)c1nc2ccccc2c(=O)n1-c1cc(OC)cc(OC)c1Br |
| InChI | InChI=1S/C29H29BrN4O6/c1-5-6-15-32(28(35)19-11-13-20(14-12-19)34(37)38)18(2)27-31-23-10-8-7-9-22(23)29(36)33(27)24-16-21(39-3)17-25(40-4)26(24)30/h7-14,16-18H,5-6,15H2,1-4H3 |
| InChIKey | NZXSGZXOVJJQJD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 116.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|