C29H30N4O5 — CID 42723626
N-butyl-N-[1-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-nitrobenzamide (PubChem CID 42723626) has the molecular formula C29H30N4O5 and a molecular weight of 514.58 g/mol. Its IUPAC name is N-butyl-N-[1-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-nitrobenzamide.
| Compound Name | N-butyl-N-[1-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 42723626 |
| Molecular Formula | C29H30N4O5 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | N-butyl-N-[1-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-nitrobenzamide |
| SMILES | CCCCN(C(=O)c1cccc([N+](=O)[O-])c1)C(C)c1nc2ccccc2c(=O)n1-c1cc(C)ccc1OC |
| InChI | InChI=1S/C29H30N4O5/c1-5-6-16-31(28(34)21-10-9-11-22(18-21)33(36)37)20(3)27-30-24-13-8-7-12-23(24)29(35)32(27)25-17-19(2)14-15-26(25)38-4/h7-15,17-18,20H,5-6,16H2,1-4H3 |
| InChIKey | VXTANVQOSYADSG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|