C31H40BrN3O4 — CID 42726524
N-[1-[3-(2-bromo-3,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylcyclohexanecarboxamide (PubChem CID 42726524) has the molecular formula C31H40BrN3O4 and a molecular weight of 598.58 g/mol. Its IUPAC name is N-[1-[3-(2-bromo-3,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylcyclohexanecarboxamide.
| Compound Name | N-[1-[3-(2-bromo-3,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylcyclohexanecarboxamide |
|---|---|
| PubChem CID | 42726524 |
| Molecular Formula | C31H40BrN3O4 |
| Molecular Weight | 598.58 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | N-[1-[3-(2-bromo-3,5-dimethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylcyclohexanecarboxamide |
| SMILES | CCCCCCN(C(=O)C1CCCCC1)C(C)c1nc2ccccc2c(=O)n1-c1cc(OC)cc(OC)c1Br |
| InChI | InChI=1S/C31H40BrN3O4/c1-5-6-7-13-18-34(30(36)22-14-9-8-10-15-22)21(2)29-33-25-17-12-11-16-24(25)31(37)35(29)26-19-23(38-3)20-27(39-4)28(26)32/h11-12,16-17,19-22H,5-10,13-15,18H2,1-4H3 |
| InChIKey | ULYMWRPFGMJYRV-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.58 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|