C27H33N3O3 — CID 42720989
N-butyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]cyclopentanecarboxamide (PubChem CID 42720989) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-butyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]cyclopentanecarboxamide.
| Compound Name | N-butyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 42720989 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | N-butyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]cyclopentanecarboxamide |
| SMILES | CCCCN(C(=O)C1CCCC1)C(C)c1nc2ccccc2c(=O)n1-c1ccccc1OC |
| InChI | InChI=1S/C27H33N3O3/c1-4-5-18-29(26(31)20-12-6-7-13-20)19(2)25-28-22-15-9-8-14-21(22)27(32)30(25)23-16-10-11-17-24(23)33-3/h8-11,14-17,19-20H,4-7,12-13,18H2,1-3H3 |
| InChIKey | GWPQJSIGLIXTDY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |