C34H40ClN3O2 — CID 42657616
N-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)-4-pentylbenzamide (PubChem CID 42657616) has the molecular formula C34H40ClN3O2 and a molecular weight of 558.17 g/mol. Its IUPAC name is N-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)-4-pentylbenzamide.
| Compound Name | N-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)-4-pentylbenzamide |
|---|---|
| PubChem CID | 42657616 |
| Molecular Formula | C34H40ClN3O2 |
| Molecular Weight | 558.17 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | N-[1-[3-(3-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)N(CCC(C)C)C(C)c2nc3ccccc3c(=O)n2-c2cccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C34H40ClN3O2/c1-6-7-8-12-26-17-19-27(20-18-26)33(39)37(22-21-23(2)3)25(5)32-36-30-15-10-9-13-28(30)34(40)38(32)31-16-11-14-29(35)24(31)4/h9-11,13-20,23,25H,6-8,12,21-22H2,1-5H3 |
| InChIKey | BBEWKUUKNXJQNM-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.17 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|