C30H32ClN3O2 — CID 42721424
4-chloro-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylbenzamide (PubChem CID 42721424) has the molecular formula C30H32ClN3O2 and a molecular weight of 502.06 g/mol. Its IUPAC name is 4-chloro-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylbenzamide.
| Compound Name | 4-chloro-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 42721424 |
| Molecular Formula | C30H32ClN3O2 |
| Molecular Weight | 502.06 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 4-chloro-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-pentylbenzamide |
| SMILES | CCCCCN(C(=O)c1ccc(Cl)cc1)C(C)c1nc2ccccc2c(=O)n1-c1ccccc1CC |
| InChI | InChI=1S/C30H32ClN3O2/c1-4-6-11-20-33(29(35)23-16-18-24(31)19-17-23)21(3)28-32-26-14-9-8-13-25(26)30(36)34(28)27-15-10-7-12-22(27)5-2/h7-10,12-19,21H,4-6,11,20H2,1-3H3 |
| InChIKey | WYOCBVJRNWCJGR-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.06 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|