C28H29N3O2 — CID 42722015
N-ethyl-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-methylbenzamide (PubChem CID 42722015) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-ethyl-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-methylbenzamide.
| Compound Name | N-ethyl-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 42722015 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N-ethyl-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-methylbenzamide |
| SMILES | CCc1ccccc1-n1c(C(C)N(CC)C(=O)c2ccc(C)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C28H29N3O2/c1-5-21-11-7-10-14-25(21)31-26(29-24-13-9-8-12-23(24)28(31)33)20(4)30(6-2)27(32)22-17-15-19(3)16-18-22/h7-18,20H,5-6H2,1-4H3 |
| InChIKey | QSUPJFPARCCKQL-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |