C30H33N3O2 — CID 42718225
4-tert-butyl-N-ethyl-N-[1-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide (PubChem CID 42718225) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is 4-tert-butyl-N-ethyl-N-[1-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-ethyl-N-[1-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 42718225 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 4-tert-butyl-N-ethyl-N-[1-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide |
| SMILES | CCN(C(=O)c1ccc(C(C)(C)C)cc1)C(C)c1nc2ccccc2c(=O)n1-c1ccccc1C |
| InChI | InChI=1S/C30H33N3O2/c1-7-32(28(34)22-16-18-23(19-17-22)30(4,5)6)21(3)27-31-25-14-10-9-13-24(25)29(35)33(27)26-15-11-8-12-20(26)2/h8-19,21H,7H2,1-6H3 |
| InChIKey | VYURYZZUASOXBS-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |