C30H27N3O3 — CID 42720907
N-ethyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]naphthalene-2-carboxamide (PubChem CID 42720907) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is N-ethyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]naphthalene-2-carboxamide.
| Compound Name | N-ethyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 42720907 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-ethyl-N-[1-[3-(2-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]naphthalene-2-carboxamide |
| SMILES | CCN(C(=O)c1ccc2ccccc2c1)C(C)c1nc2ccccc2c(=O)n1-c1ccccc1OC |
| InChI | InChI=1S/C30H27N3O3/c1-4-32(29(34)23-18-17-21-11-5-6-12-22(21)19-23)20(2)28-31-25-14-8-7-13-24(25)30(35)33(28)26-15-9-10-16-27(26)36-3/h5-20H,4H2,1-3H3 |
| InChIKey | LNUUJKXASSAXKB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |