C27H27N3O2 — CID 42721554
N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methyl-2-phenylacetamide (PubChem CID 42721554) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methyl-2-phenylacetamide.
| Compound Name | N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methyl-2-phenylacetamide |
|---|---|
| PubChem CID | 42721554 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methyl-2-phenylacetamide |
| SMILES | CCc1ccccc1-n1c(C(C)N(C)C(=O)Cc2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H27N3O2/c1-4-21-14-8-11-17-24(21)30-26(28-23-16-10-9-15-22(23)27(30)32)19(2)29(3)25(31)18-20-12-6-5-7-13-20/h5-17,19H,4,18H2,1-3H3 |
| InChIKey | OQOGFZBXWIFWQF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |