C27H36N4O2 — CID 42721442
N-[2-(dimethylamino)ethyl]-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]pentanamide (PubChem CID 42721442) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]pentanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]pentanamide |
|---|---|
| PubChem CID | 42721442 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]pentanamide |
| SMILES | CCCCC(=O)N(CCN(C)C)C(C)c1nc2ccccc2c(=O)n1-c1ccccc1CC |
| InChI | InChI=1S/C27H36N4O2/c1-6-8-17-25(32)30(19-18-29(4)5)20(3)26-28-23-15-11-10-14-22(23)27(33)31(26)24-16-12-9-13-21(24)7-2/h9-16,20H,6-8,17-19H2,1-5H3 |
| InChIKey | ZCLFGMTXYAPGPK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |