C31H33N3O2 — CID 42726527
(E)-N-butyl-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 42726527) has the molecular formula C31H33N3O2 and a molecular weight of 479.62 g/mol. Its IUPAC name is (E)-N-butyl-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-butyl-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 42726527 |
| Molecular Formula | C31H33N3O2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | (E)-N-butyl-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | CCCCN(C(=O)/C=C/c1ccccc1)C(C)c1nc2ccccc2c(=O)n1-c1ccccc1CC |
| InChI | InChI=1S/C31H33N3O2/c1-4-6-22-33(29(35)21-20-24-14-8-7-9-15-24)23(3)30-32-27-18-12-11-17-26(27)31(36)34(30)28-19-13-10-16-25(28)5-2/h7-21,23H,4-6,22H2,1-3H3/b21-20+ |
| InChIKey | OZHMQSAJPYOYBZ-QZQOTICOSA-N |
| XLogP | 6.35 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|