C31H32ClN3O2 — CID 42717440
(E)-N-[1-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexyl-3-phenylprop-2-enamide (PubChem CID 42717440) has the molecular formula C31H32ClN3O2 and a molecular weight of 514.07 g/mol. Its IUPAC name is (E)-N-[1-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexyl-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[1-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 42717440 |
| Molecular Formula | C31H32ClN3O2 |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | (E)-N-[1-[3-(3-chlorophenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexyl-3-phenylprop-2-enamide |
| SMILES | CCCCCCN(C(=O)/C=C/c1ccccc1)C(C)c1nc2ccccc2c(=O)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C31H32ClN3O2/c1-3-4-5-11-21-34(29(36)20-19-24-13-7-6-8-14-24)23(2)30-33-28-18-10-9-17-27(28)31(37)35(30)26-16-12-15-25(32)22-26/h6-10,12-20,22-23H,3-5,11,21H2,1-2H3/b20-19+ |
| InChIKey | JUUZATMDOYPGID-FMQUCBEESA-N |
| XLogP | 7.22 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|