C29H39N3O2 — CID 42719055
N-hexyl-3,3-dimethyl-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]butanamide (PubChem CID 42719055) has the molecular formula C29H39N3O2 and a molecular weight of 461.65 g/mol. Its IUPAC name is N-hexyl-3,3-dimethyl-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]butanamide.
| Compound Name | N-hexyl-3,3-dimethyl-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 42719055 |
| Molecular Formula | C29H39N3O2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | N-hexyl-3,3-dimethyl-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]butanamide |
| SMILES | CCCCCCN(C(=O)CC(C)(C)C)C(C)c1nc2ccccc2c(=O)n1-c1cccc(C)c1 |
| InChI | InChI=1S/C29H39N3O2/c1-7-8-9-12-18-31(26(33)20-29(4,5)6)22(3)27-30-25-17-11-10-16-24(25)28(34)32(27)23-15-13-14-21(2)19-23/h10-11,13-17,19,22H,7-9,12,18,20H2,1-6H3 |
| InChIKey | RSFRJMFXLUOOFV-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|