C26H24ClN3O2 — CID 42721552
2-chloro-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylbenzamide (PubChem CID 42721552) has the molecular formula C26H24ClN3O2 and a molecular weight of 445.95 g/mol. Its IUPAC name is 2-chloro-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylbenzamide.
| Compound Name | 2-chloro-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 42721552 |
| Molecular Formula | C26H24ClN3O2 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-chloro-N-[1-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-methylbenzamide |
| SMILES | CCc1ccccc1-n1c(C(C)N(C)C(=O)c2ccccc2Cl)nc2ccccc2c1=O |
| InChI | InChI=1S/C26H24ClN3O2/c1-4-18-11-5-10-16-23(18)30-24(28-22-15-9-7-13-20(22)26(30)32)17(2)29(3)25(31)19-12-6-8-14-21(19)27/h5-17H,4H2,1-3H3 |
| InChIKey | WQLYVBMKJYFZCC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |