C27H26ClN3O3 — CID 42723571
2-chloro-N-ethyl-N-[1-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide (PubChem CID 42723571) has the molecular formula C27H26ClN3O3 and a molecular weight of 475.98 g/mol. Its IUPAC name is 2-chloro-N-ethyl-N-[1-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide.
| Compound Name | 2-chloro-N-ethyl-N-[1-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 42723571 |
| Molecular Formula | C27H26ClN3O3 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-chloro-N-ethyl-N-[1-[3-(2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide |
| SMILES | CCN(C(=O)c1ccccc1Cl)C(C)c1nc2ccccc2c(=O)n1-c1cc(C)ccc1OC |
| InChI | InChI=1S/C27H26ClN3O3/c1-5-30(26(32)19-10-6-8-12-21(19)28)18(3)25-29-22-13-9-7-11-20(22)27(33)31(25)23-16-17(2)14-15-24(23)34-4/h6-16,18H,5H2,1-4H3 |
| InChIKey | ZHGSMVMQURUQEJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |