C30H31Cl2N3O2 — CID 4032184
4-chloro-N-[1-[3-(4-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylbenzamide (PubChem CID 4032184) has the molecular formula C30H31Cl2N3O2 and a molecular weight of 536.50 g/mol. Its IUPAC name is 4-chloro-N-[1-[3-(4-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylbenzamide.
| Compound Name | 4-chloro-N-[1-[3-(4-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylbenzamide |
|---|---|
| PubChem CID | 4032184 |
| Molecular Formula | C30H31Cl2N3O2 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 4-chloro-N-[1-[3-(4-chloro-2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-hexylbenzamide |
| SMILES | CCCCCCN(C(=O)c1ccc(Cl)cc1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(Cl)cc1C |
| InChI | InChI=1S/C30H31Cl2N3O2/c1-4-5-6-9-18-34(29(36)22-12-14-23(31)15-13-22)21(3)28-33-26-11-8-7-10-25(26)30(37)35(28)27-17-16-24(32)19-20(27)2/h7-8,10-17,19,21H,4-6,9,18H2,1-3H3 |
| InChIKey | PACGZQYYGKDEHQ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|