C31H34FN3O2 — CID 42720685
N-[1-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-fluoro-N-hexylbenzamide (PubChem CID 42720685) has the molecular formula C31H34FN3O2 and a molecular weight of 499.63 g/mol. Its IUPAC name is N-[1-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-fluoro-N-hexylbenzamide.
| Compound Name | N-[1-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-fluoro-N-hexylbenzamide |
|---|---|
| PubChem CID | 42720685 |
| Molecular Formula | C31H34FN3O2 |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | N-[1-[3-(2,5-dimethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-fluoro-N-hexylbenzamide |
| SMILES | CCCCCCN(C(=O)c1ccc(F)cc1)C(C)c1nc2ccccc2c(=O)n1-c1cc(C)ccc1C |
| InChI | InChI=1S/C31H34FN3O2/c1-5-6-7-10-19-34(30(36)24-15-17-25(32)18-16-24)23(4)29-33-27-12-9-8-11-26(27)31(37)35(29)28-20-21(2)13-14-22(28)3/h8-9,11-18,20,23H,5-7,10,19H2,1-4H3 |
| InChIKey | OTBGPDWHNDECJY-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|