C24H28ClN3O2 — CID 4559937
2-chloro-N-(3-methylbutyl)-N-[1-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]acetamide (PubChem CID 4559937) has the molecular formula C24H28ClN3O2 and a molecular weight of 425.96 g/mol. Its IUPAC name is 2-chloro-N-(3-methylbutyl)-N-[1-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]acetamide.
| Compound Name | 2-chloro-N-(3-methylbutyl)-N-[1-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 4559937 |
| Molecular Formula | C24H28ClN3O2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 2-chloro-N-(3-methylbutyl)-N-[1-[3-(2-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]acetamide |
| SMILES | Cc1ccccc1-n1c(C(C)N(CCC(C)C)C(=O)CCl)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H28ClN3O2/c1-16(2)13-14-27(22(29)15-25)18(4)23-26-20-11-7-6-10-19(20)24(30)28(23)21-12-8-5-9-17(21)3/h5-12,16,18H,13-15H2,1-4H3 |
| InChIKey | JXAFLNVKDPWNOG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|