C22H23BrClN3O2 — CID 42713910
4-bromo-N-butyl-N-[1-(6-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]benzamide (PubChem CID 42713910) has the molecular formula C22H23BrClN3O2 and a molecular weight of 476.80 g/mol. Its IUPAC name is 4-bromo-N-butyl-N-[1-(6-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]benzamide.
| Compound Name | 4-bromo-N-butyl-N-[1-(6-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 42713910 |
| Molecular Formula | C22H23BrClN3O2 |
| Molecular Weight | 476.80 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 4-bromo-N-butyl-N-[1-(6-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]benzamide |
| SMILES | CCCCN(C(=O)c1ccc(Br)cc1)C(C)c1nc2ccc(Cl)cc2c(=O)n1C |
| InChI | InChI=1S/C22H23BrClN3O2/c1-4-5-12-27(21(28)15-6-8-16(23)9-7-15)14(2)20-25-19-11-10-17(24)13-18(19)22(29)26(20)3/h6-11,13-14H,4-5,12H2,1-3H3 |
| InChIKey | LRLHLZPFKBEQRS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.80 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |