C18H24ClN3O3 — CID 42713965
N-[1-(6-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-(2-methoxyethyl)butanamide (PubChem CID 42713965) has the molecular formula C18H24ClN3O3 and a molecular weight of 365.86 g/mol. Its IUPAC name is N-[1-(6-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-(2-methoxyethyl)butanamide.
| Compound Name | N-[1-(6-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-(2-methoxyethyl)butanamide |
|---|---|
| PubChem CID | 42713965 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-[1-(6-chloro-3-methyl-4-oxoquinazolin-2-yl)ethyl]-N-(2-methoxyethyl)butanamide |
| SMILES | CCCC(=O)N(CCOC)C(C)c1nc2ccc(Cl)cc2c(=O)n1C |
| InChI | InChI=1S/C18H24ClN3O3/c1-5-6-16(23)22(9-10-25-4)12(2)17-20-15-8-7-13(19)11-14(15)18(24)21(17)3/h7-8,11-12H,5-6,9-10H2,1-4H3 |
| InChIKey | GONBHRKBSHBPJF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |